| Identification | |
| Name: | Urea, N,N-diethyl- |
| Synonyms: | Urea,1,1-diethyl- (6CI,7CI,8CI); 1,1-Diethylurea; N,N-Diethylurea; NSC 165657;asym-Diethylurea |
| CAS: | 634-95-7 |
| EINECS: | 211-220-3 |
| Molecular Formula: | C5H12 N2 O |
| Molecular Weight: | 116.16158 |
| InChI: | InChI=1S/C5H12N2O/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3,(H2,6,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.975 g/cm3 |
| Water Solubility: | soluble in water,soluble in acetone (1g/20 ml),soluble in alcohol and benzene |
| Solubility: | soluble in water,soluble in acetone (1g/20 ml),soluble in alcohol and benzene |
| Appearance: | light yellow powder. |
| Specification: | white semi-transparent crystals Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
