| Identification | |
| Name: | 6H-Purin-6-one,2-amino-1,9-dihydro-, hydrochloride (1:1) |
| Synonyms: | 6H-Purin-6-one,2-amino-1,7-dihydro-, monohydrochloride (9CI);Guanine, monohydrochloride(8CI);Guaninium chloride; |
| CAS: | 635-39-2 |
| EINECS: | 211-235-5 |
| Molecular Formula: | C5H6ClN5O |
| Molecular Weight: | 187.59 |
| InChI: | InChI=1/C5H5N5O.ClH/c6-5-9-3-2(4(11)10-5)7-1-8-3;/h1H,(H4,6,7,8,9,10,11);1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 300ºC |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | white to light yellow crystal powder |
| Specification: | White to pale yellow crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | 2-8°C |
| Usage: | A purine nucleoside composed of guanine and ribose. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
