| Identification |
| Name: | Butanedioicacid, 2-phenyl- |
| Synonyms: | Butanedioicacid, phenyl- (9CI);Succinic acid, phenyl- (6CI,7CI,8CI);(RS)-Phenylsuccinicacid;2-Phenylbutanedioic acid;2-Phenylsuccinic acid;NSC 11342;NSC 16635;Phenylsuccinic acid;a-Phenylsuccinicacid; |
| CAS: | 635-51-8 |
| EINECS: | 211-238-1 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.184 |
| InChI: | InChI=1S/C10H10O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 166-169 ºC |
| Density: | 1.336 g/cm3 |
| Stability: | Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | Very soluble in water |
| Solubility: | Very soluble in water |
| Appearance: | Off white to light yellow powder |
| HS Code: | 29173980 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Drug and chiral compound intermediate. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
