| Identification | ||
| Name: | Phenol,2-amino-4-chloro-5-nitro- | |
| Synonyms: | 2-Amino-4-chloro-5-nitrophenol;4-Chloro-5-nitro-2-aminophenol;NSC 7537; | |
| CAS: | 6358-07-2 | |
| EINECS: | 228-760-0 | |
| Molecular Formula: | C6H5ClN2O3 | |
| Molecular Weight: | 188.57 | |
| InChI: | InChI=1/C6H5ClN2O3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H,8H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.655 g/cm3 | |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.695 | |
| Water Solubility: | <0.01 g/100 mL at 22 ºC | |
| Solubility: | <0.01 g/100 mL at 22 ºC in water | |
| Appearance: | orange powder | |
| Specification: | orange powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
