| Identification | |
| Name: | 2-Propanol,1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-[(1-methylethyl)amino]- |
| Synonyms: | 1-Isopropylamino-3-[4-(2-cyclopropylmethoxy-ethyl)phenoxy]-2-propanol;Betaxolol;Betoptic S; |
| CAS: | 63659-18-7 |
| Molecular Formula: | C18H29NO3 |
| Molecular Weight: | 307.43 |
| InChI: | InChI=1/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3 |
| Molecular Structure: | ![(C18H29NO3) 1-Isopropylamino-3-[4-(2-cyclopropylmethoxy-ethyl)phenoxy]-2-propanol;Betaxolol;Betoptic S;](https://img.guidechem.com/casimg/63659-18-7.gif) |
| Properties | |
| Density: | 1.067 g/cm3 |
| Appearance: | White crystalline solid |
| Specification: |
Betaxolol (63659-18-7) also can be called Betoptic , Betoptic S , Lokren ,and Kerlone .It typically has fewer systemic side effects than non-selective beta-blockers, for example, not causing bronchospasm (mediated by beta2 receptors) as timolol may.In addition to its effect on the heart, betaxolol reduces the pressure within the eye (intraocular pressure). This effect is thought to be caused by reducing the production of the liquid (which is called the aqueous humor) within the eye. The precise mechanism of this effect is not known. The reduction in intraocular pressure reduces the risk of damage to the optic nerve and loss of vision in patients with elevated intraocular pressure due to glaucoma.It also shows greater affininty for beta1 receptors than metoprolol. |
| Usage: | Cardioselective 1-adrenergic blocker. An antihypertensive; antiglaucoma |
| Safety Data | |
 |
|
