| Identification | |
| Name: | p-Tolylhydrazine hydrochloride |
| Synonyms: | p-tolylhydrazinium(1+) chloride; p-Tolylhydrazine HCL; 4-Methylphenylhydrazine hydrochloride; 4-METHYLPHENYLHYDRAZINE HCL; 4-TOLYLHYDRAZINE HCL; 4-TOLYLHYDRAZINE HYDROCHLORIDE; P-METHYLPHENYLHYDRAZINE HYDROCHLORIDE; P-TOLYL HYDRAZINE HCL; (4-Methylphenyl)hydrazinemonohydrochloride; (4-methylphenyl)-hydrazinmonohydrochloride; p-tolyl-hydrazinhydrochloride |
| CAS: | 637-60-5 |
| EINECS: | 211-295-2 |
| Molecular Formula: | C7H10N2?HCl |
| Molecular Weight: | 158.63 |
| InChI: | InChI=1/C7H10N2.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,8H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Density: | 1.18 |
| Stability: | No data. |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | White powder |
| Specification: | off-white to beige-brownish flaky powder Safety Statements:26-36-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29280090 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
