| Identification | |
| Name: | 1-Chloro-4-iodobenzene |
| Synonyms: | 4-Chloroiodobenzene |
| CAS: | 637-87-6 |
| EINECS: | 211-305-5 |
| Molecular Formula: | C6H4ClI |
| Molecular Weight: | 238.45 |
| InChI: | InChI=1/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 226 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5262 (20 C) |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?1-Chloro-4-iodobenzene , its cas register number is 637-87-6. It also can be called 1-chloro-4-iodo-benzen ; 4-Iodochlorobenzene ; p-Chlorophenyliodide ; and Benzene,1-chloro-4-iodo- . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
