| Identification | |
| Name: | 1,4-Cyclohexanedione |
| Synonyms: | 1,4-Dioxocyclohexane;Tetrahydroquinone;Cyclohexan-1,4-dione;1,4-Cyclohexane Dione;1,4-Cyclohexanedione(CAS:637-88-7); |
| CAS: | 637-88-7 |
| EINECS: | 211-306-0 |
| Molecular Formula: | C6H8O2 |
| Molecular Weight: | 112.13 |
| InChI: | InChI=1/C6H8O2/c7-5-1-2-6(8)4-3-5/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.127 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.474? |
| Solubility: | Very soluble |
| Appearance: | yellow to beige crystalline powder |
| Specification: |
?1,4-Cyclohexanedione?(CAS NO.637-88-7)?is the organic compound. This colourless solid is one of the three isomeric cyclohexanediones. This particular diketone is used as a building block in the synthesis of more complex molecules. |
| HS Code: | 29142900 |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
