| Identification | |
| Name: | Nonanoic acid,oxydi-3,1-propanediyl ester (9CI) |
| Synonyms: | Bisnonanoic acid oxybis(3,1-propanediyl) ester;Emery X-88R |
| CAS: | 63716-17-6 |
| Molecular Formula: | C24H46 O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H38O4.2C3H6/c1-3-5-7-9-11-13-15-19(21)23-17-18-24-20(22)16-14-12-10-8-6-4-2;2*1-3-2/h3-18H2,1-2H3;2*3H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Di-propylene glycol di-pelargonate , its cas register number is 63716-17-6. It also can be called 1-Propanol, 3,3'-oxydi-, dipelargonate ; Emery X-88-R ; and Nonanoic acid, oxydipropylene ester . |
| Safety Data | |
 |
|
