| Identification | |
| Name: | Hexanoic acid, hexylester |
| Synonyms: | 1-Hexylcaproate;1-Hexyl hexanoate;Hexyl caproate;Hexyl hexanoate;Hexyl hexoate;NSC 53799;n-Hexyl hexanoate;n-Hexyl n-hexanoate;AI3-06035;BRN 1762037; |
| CAS: | 6378-65-0 |
| EINECS: | 228-952-4 |
| Molecular Formula: | C12H24O2 |
| Molecular Weight: | 200.32 |
| InChI: | InChI=1/C12H24O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h3-11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 211? |
| Density: | 0.863 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.424 |
| Solubility: | Insoluble |
| Appearance: | Colorless to slightly yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 211? |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Flavoring. |
| Safety Data | |
 |
|
