Identification |
Name: | 2-Butenoic acid,3-methyl-, ethyl ester |
Synonyms: | Senecioic acid, ethyl ester (6CI);3-Methyl-2-butenoic acid ethyl ester;Ethyl 3,3-dimethylacrylate;Ethyl3-methyl-2-butenoate;Ethyl 3-methylcrotonate;Ethyl dimethylacrylate;Ethylisobutenoate;Ethyl isopropylideneacetate;Ethyl senecioate;Ethyl b,b-dimethylacrylate;Ethyl b-methylcrotonate;NSC 61853;NSC 99208;Crotonicacid, 3-methyl-, ethyl ester (7CI,8CI); |
CAS: | 638-10-8 |
EINECS: | 211-319-1 |
Molecular Formula: | C7H12O2 |
Molecular Weight: | 128.17 |
InChI: | InChI=1/C7H12O2/c1-4-9-7(8)5-6(2)3/h5H,4H2,1-3H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3272 |
Flash Point: | 93? |
Density: | 0.922 |
Stability: | Stable. Flammable. Incompatible with acids, bases, oxidizing agents, reducing agents. |
Refractive index: | 1.436 |
Solubility: | Insoluble |
Appearance: | colorless liquid |
Packinggroup: | III |
Flash Point: | 93? |
Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. Store in a cool dry place. |
Usage: | Food additive for flavor. |
Safety Data |
|
|