| Identification | |
| Name: | Mercury,[bis(1-methylethyl) phosphito-P]chloro- (9CI) |
| Synonyms: | Phosphonicacid, (chloromercuri)-, diisopropyl ester (6CI); Phosphorous acid,bis(1-methylethyl) ester, mercury complex |
| CAS: | 63869-02-3 |
| Molecular Formula: | C6H14 Cl Hg O3 P |
| Molecular Weight: | 401.21 |
| InChI: | InChI=1/C6H15O3P.ClH.Hg/c1-5(2)8-10(7)9-6(3)4;;/h5-6,10H,1-4H3;1H;/q;;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 90.3°C |
| Boiling Point: | 195.5°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Chloro(Diisopropoxyphosphinyl) Mercury , its cas register number is 63869-02-3. It also can be called Mercury chloride, (diisopropoxyphosphinyl)- . Its classification code is Organometallic. |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 90.3°C |
| Safety Data | |
 |
|
