| Identification | |
| Name: | Phenol,4-(di-2-propen-1-ylamino)-3,5-dimethyl-, 1-(N-methylcarbamate) |
| Synonyms: | Carbamicacid, methyl-, 4-(diallylamino)-3,5-xylyl ester (7CI,8CI); Phenol, 4-(di-2-propenylamino)-3,5-dimethyl-,methylcarbamate (ester) (9CI); 3,5-Xylenol, 4-(diallylamino)-, methylcarbamate(ester) (8CI); 3,5-Dimethyl-4-diallylaminophenyl-N-methylcarbamate;4-Diallylamino-3,5-dimethylphenyl N-methylcarbamate;4-Diallylamino-3,5-dimethylphenyl methylcarbamate; 4-Diallylamino-3,5-xylylN-methylcarbamate; 4-Diallylamino-3,5-xylyl methylcarbamate; APC; APC(pesticide); Allyxycarb; BAY 50282; Hydrol; Hydrol (insecticide) |
| CAS: | 6392-46-7 |
| EINECS: | 229-002-1 |
| Molecular Formula: | C16H22 N2 O2 |
| Molecular Weight: | 274.40 |
| InChI: | InChI=1/C16H22N2O2/c1-6-8-18(9-7-2)15-12(3)10-14(11-13(15)4)20-16(19)17-5/h6-7,10-11H,1-2,8-9H2,3-5H3,(H,17,19) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2757 |
| Density: | 1.044 g/cm3 |
| Refractive index: | 1.545 |
| Specification: |
4-Diallylamino-3,5-dimethylphenyl-N-methylcarbamate (CAS NO.6392-46-7) is also called Allyxycarb ; Allyxycarb emulsion ; Hydrol ; Hydrol emulsion ; 4-Diallylamino-3,5-xylyl methylcarbamate ; [4-(Di(prop-2-enyl)amino)-3,5-dimethylphenyl] N-methylcarbamate ; APC(pesticide) ; B-50282 . 4-Diallylamino-3,5-dimethylphenyl-N-methylcarbamate (CAS NO.6392-46-7) is high toxic. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep it separate from raw materials of food. |
| Packinggroup: | III |
| Safety Data | |
 |
|
