| Identification | |
| Name: | 2-Cyclopenten-1-one,3-(dimethylamino)-2-hydroxy-5-methylene- |
| Synonyms: | 3-Dimethylamino-2-hydroxy-5-methylene-2-cyclopenten-1-one |
| CAS: | 63937-30-4 |
| Molecular Formula: | C8H11 N O2 |
| Molecular Weight: | 153.20 |
| InChI: | InChI=1/C8H11NO2/c1-5-4-6(9(2)3)8(11)7(5)10/h11H,1,4H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.8°C |
| Boiling Point: | 267.9°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.543 |
| Specification: |
Anhydro-dimethylamino hexose reductone ,its CAS number is 63937-30-4,it can be called ADMA and 2-Cyclopenten-1-one, 3-dimethylamino-2-hydroxy-5-methylene- . It is a toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 115.8°C |
| Safety Data | |
 |
|
