| Identification | |
| Name: | Benzenemethanol, a-(1-aminoethyl)-4-methoxy-,hydrochloride (1:1) |
| Synonyms: | Benzenemethanol,a-(1-aminoethyl)-4-methoxy-,hydrochloride (9CI); 2-Amino-1-(4-methoxyphenyl)-1-propanol hydrochloride; NSC117791 |
| CAS: | 63991-23-1 |
| Molecular Formula: | C10H15 N O2 . Cl H |
| Molecular Weight: | 217.72 |
| InChI: | InChI=1/C10H15NO2.ClH/c1-7(11)10(12)8-3-5-9(13-2)6-4-8;/h3-7,10,12H,11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.2°C |
| Boiling Point: | 329.7°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
alpha-(1-Aminoethyl)-4-methoxybenzyl alcohol hydrochloride , its cas register number is 63991-23-1. It also can be called Pantothenate de zinc ; and Benzyl alcohol, alpha-(1-aminoethyl)-4-methoxy-, hydrochloride . |
| Flash Point: | 153.2°C |
| Safety Data | |
 |
|
