| Identification | |
| Name: | Urea, N-phenyl- |
| Synonyms: | Urea,phenyl- (8CI,9CI); 1-Phenylurea; Ethyl 5-nitro-1H-indole-3-carboxylate;Monophenylurea; N-Phenylurea; NSC 2781; Phenylcarbamide; Phenylurea;Stabilisator VH; Stabilizer VH; VH |
| CAS: | 64-10-8 |
| EINECS: | 200-576-5 |
| Molecular Formula: | C7H8 N2 O |
| Molecular Weight: | 136.15122 |
| InChI: | InChI=1S/C7H8N2O/c8-7(10)9-6-4-2-1-3-5-6/h1-5H,(H3,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.302 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed. May be harmful if inhaled orabsorbed through the skin. Toxicology not fully investigated. |
| Solubility: |
|
| Appearance: | off-white powder |
| Specification: |
A solid or liquid absorbed on a dry carrier. A wettable powder. Contains any of several related products (Diuron, Fenuron, Linuron, Monuron, Neburon, Siduron) formally derived from urea. Toxic by inhalation, skin absorption, or ingestion. Obtain the technical name of the specific pesticide from the shipping papers and contact CHEMTREC, 800-424-9300 for response information. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
