| Identification | |
| Name: | D-Valine |
| Synonyms: | H-D-Val-OH;D-Valin;Valine, D-;(2R)-2-amino-3-methyl-butanoic acid;(2R)-2-amino-3-methylbutanoic acid;(R)-2-Amino-3-methylbutyric acid;(R)-Valine;(R)-2-Amino-3-methylbutanoic acid;-Valine; |
| CAS: | 640-68-6 |
| EINECS: | 211-368-9 |
| Molecular Formula: | C5H11NO2 |
| Molecular Weight: | 117.15 |
| InChI: | InChI=1/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.063 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Alpha: | -27.5 o (C=5, 5N HCL) |
| Solubility: | Appearance:white crystals Transport Information:25kgs Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | white crystals |
| Specification: | white to off-white crystalline powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Usage: | L form is an essential amino acid in humans. |
| Safety Data | |
| Hazard Symbols | |
 |
|
