| Identification |
| Name: | 2H-Pyran-2,4(3H)-dione,3-acetyl-6-methyl-, ion(1-), sodium, monohydrate (9CI) |
| Synonyms: | 2H-Pyran-2,4(3H)-dione, 3-acetyl-6-methyl-, sodium salt, monohydrate;3-Acetyl-6-methyl-2H-pyran-2,4(3H)-dione, sodium salt, monohydrate; |
| CAS: | 64039-28-7 |
| Molecular Formula: | C8H9NaO5 |
| Molecular Weight: | 208.1438 |
| InChI: | InChI=1/C8H8O4.Na.H2O/c1-4-3-6(10)7(5(2)9)8(11)12-4;;/h3,11H,1-2H3;;1H2/q;+1;/p-1 |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Appearance: | white to off-white powder |
| Usage: | Dehydroacetic acid sodium salt monohydrate is used in the food industry as preservative for fruits, vegetables, fruit juice, honey, beer, milk, protein and fat products; in human and veterinary medicine as bactericide and fungicide. Product Data Sheet |
| Safety Data |
| |
 |
