| Identification |
| Name: | Fast black K salt |
| Synonyms: | 2,5-Dimethoxy-4-((4-nitrophenyl)azo)benzenediazonium tetrachlorozincate (2:1);Dichlorozinc; [2,5-dimethoxy-4-(4-nitrophenyl)diazenyl-phenyl]iminoazanium; chloride; |
| CAS: | 64071-86-9 |
| EINECS: | 248-648-5 |
| Molecular Formula: | C14H14Cl3N5O4Zn |
| Molecular Weight: | 488.06006 |
| InChI: | InChI=1S/C14H13N5O4.3ClH.Zn/c1-22-13-8-12(14(23-2)7-11(13)16-15)18-17-9-3-5-10(6-4-9)19(20)21;;;;/h3-8,15H,1-2H3;3*1H;/q;;;;+2/p-2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 150 °C (dec.)(lit.)
|
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong bases, strong oxidizing agents.Toxicology Eye irritant. Risk phrases (The meaning of any risk phrases which appear in this s |
| Solubility: | |
| Appearance: | dark brown powder |
| Storage Temperature: | Refrigerator |
| Safety Data |
| |
 |
