| Identification | |
| Name: | Methanone,1-naphthalenylphenyl- |
| Synonyms: | Ketone,1-naphthyl phenyl (6CI,7CI,8CI); (1-Naphthalenyl)phenyl methanone;1-Benzoylnaphthalene; 1-Naphthophenone; 1-Naphthyl phenyl ketone; NSC 6729;Phenyl 1-naphthyl ketone; a-Benzoylnaphthalene; a-Naphthyl phenyl ketone |
| CAS: | 642-29-5 |
| EINECS: | 211-382-5 |
| Molecular Formula: | C17H12O |
| Molecular Weight: | 232.28 |
| InChI: | InChI=1/C17H12O/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16/h1-12H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.7°C |
| Boiling Point: | 385°C at 760 mmHg |
| Density: | 1.151g/cm3 |
| Refractive index: | 1.653 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 174.7°C |
| Safety Data | |
 |
|
