| Identification | |
| Name: | 1,2-Phthalic dicarboxaldehyde |
| Synonyms: | ortho-Phthalaldehyde |
| CAS: | 643-79-8 |
| EINECS: | 211-402-2 |
| Molecular Formula: | C8H6O2 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C8H6O2/c9-5-7-3-1-2-4-8(7)6-10/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 175 |
| Density: | 1.13 |
| Stability: | Stable. Air sensitive. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.622? |
| Water Solubility: | soluble |
| Solubility: | In water |
| Appearance: | Light yellow crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29122900 |
| Sensitive: | Air Sensitive |
| Color: | yellow |
| Usage: | A reagent in the analysis of amino acids. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
