| Identification |
| Name: | 1,1'-Biphenyl,3-methyl- |
| Synonyms: | Biphenyl,3-methyl- (8CI); (3-Methylphenyl)benzene; 3-Methyl-1,1'-biphenyl;3-Methylbiphenyl; 3-Methyldiphenyl; 3-Phenyltoluene; m-Methylbiphenyl;m-Phenyltoluene |
| CAS: | 643-93-6 |
| EINECS: | 211-404-3 |
| Molecular Formula: | C13H12 |
| Molecular Weight: | 168.24 |
| InChI: | InChI=1/C13H12/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12/h2-10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.018 |
| Stability: | No data. |
| Refractive index: | 1.601-1.605 |
| Solubility: | Insoluble |
| Appearance: | colorless to yellow liquid |
| Specification: |
The extinguishing agent of 3-Methylbiphenyl (CAS No.643-93-6 ) are dry powder, foam, sand, carbon dioxide, water mist.
|
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |