| Identification | |
| Name: | 4-Thiazoleacetic acid,2-amino-a-(hydroxyimino)-, ethyl ester, (aZ)- |
| Synonyms: | 4-Thiazoleaceticacid, 2-amino-a-(hydroxyimino)-,ethyl ester, (Z)-;Ethyl (Z)-2-(2-aminothiazol-4-yl)-2-(hydroxyimino)acetate; |
| CAS: | 64485-82-1 |
| EINECS: | 264-910-1 |
| Molecular Formula: | C7H9N3O3S |
| Molecular Weight: | 215.22966 |
| InChI: | InChI=1S/C7H9N3O3S/c1-2-13-6(11)5(10-12)4-3-14-7(8)9-4/h3,12H,2H2,1H3,(H2,8,9)/b10-5- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.56 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.662 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes |
| Appearance: | yellow to beige powder |
| Specification: |
Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate , with CAS number of 64485-82-1, can be called ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate ; Ethyl 2-amino-alpha-(hydroxyimino)-4-thiazoleacetate ; ehata ; 4-Thiazoleacetic acid, 2-amino-alpha-(hydroxyimino)-, ethyl ester . It is a light yellow to beige fine powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
