| Identification | |
| Name: | Benzaldehyde,2-bromo-4-methoxy-5-(phenylmethoxy)- |
| Synonyms: | Benzaldehyde,5-(benzyloxy)-2-bromo-4-methoxy- (7CI,8CI);5-Benzyloxy-2-bromo-4-methoxybenzaldehyde;6-Bromobenzylisovanillin; |
| CAS: | 6451-86-1 |
| Molecular Formula: | C15H13BrO3 |
| Molecular Weight: | 321.17 |
| InChI: | InChI=1/C15H13BrO3/c1-18-14-8-13(16)12(9-17)7-15(14)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 212.3°C |
| Boiling Point: | 427.5°C at 760 mmHg |
| Density: | 1.421g/cm3 |
| Refractive index: | 1.611 |
| Specification: |
2-Bromo-4-methoxy-5-(benzyloxy)benzaldehyde with cas registry number of 6451-86-1 is also known as 5-(Benzyloxy)-2-bromo-4-methoxybenzaldehyde ; Benzaldehyde, 2-bromo-4-methoxy-5-(phenylmethoxy)- ; 5-Benzyloxy-2-bromo-4-methoxybenzaldehyde ; 6-Bromobenzyl isovanillin . It is a compound with the appearance of white crystal . |
| Flash Point: | 212.3°C |
| Safety Data | |
 |
|
