| Identification | |
| Name: | Isobutyl stearate |
| Synonyms: | Stearicacid, isobutyl ester (6CI,7CI,8CI);2-Methylpropyl stearate;Estol 1476;Isobutyl octadecanoate; |
| CAS: | 646-13-9 |
| EINECS: | 211-466-1 |
| Molecular Formula: | C22H44O2 |
| Molecular Weight: | 340.58356 |
| InChI: | InChI=1S/C22H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23)24-20-21(2)3/h21H,4-20H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 20ºC |
| Density: | 0.861 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.447 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Waxy, crystalline solid. |
| Specification: |
Isobutyl stearate ,its CAS NO. is 646-13-9,the synonyms is Octadecanoic acid, 2-methylpropyl ester ; Isobutyloctadecanoate ; Octadecanoicacid,2-methyl- ; Stearic acid, isobutyl ester ; 2-Methylpropyl octadecanoate ; Octadecanoic acid isobutyl ester ; Stearic acid 2-methylpropyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | WAX Paraffin-like, crystal substance @ low temp Waxy, crystalline solid |
| Usage: | In waterproof coatings, polishes, face creams, rouges, ointments, soaps, rubber mfr, dye soln, inks, lubricants. |
| Safety Data | |
 |
|
