| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 1,2,3,6-tetrahydro- |
| Synonyms: | Isoguvacine |
| CAS: | 64603-90-3 |
| Molecular Formula: | C6H9 N O2 |
| Molecular Weight: | 163.6 |
| InChI: | InChI=1/C6H9NO2.ClH/c8-6(9)5-1-3-7-4-2-5;/h1,7H,2-4H2,(H,8,9);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 123.6°C |
| Boiling Point: | 280.8°C at 760 mmHg |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Specific GABA A receptor agonist. |
| Flash Point: | 123.6°C |
| Storage Temperature: | Store at RT |
| Color: | white |
| Safety Data | |
 |
|
