| Identification | |
| Name: | Isoxazolo[5,4-c]pyridin-3(2H)-one,4,5,6,7-tetrahydro- |
| Synonyms: | 4,5,6,7-Tetrahydroisoxazolo[5,4-c]pyridin-3(2H)-one;4,5,6,7-Tetrahydroisoxazolo[5,4-c]pyridin-3-ol; Gaboxadol; Lu 02-030; THIP |
| CAS: | 64603-91-4 |
| EINECS: | 264-963-0 |
| Molecular Formula: | C6H8 N2 O2 |
| Molecular Weight: | 140.13992 |
| InChI: | InChI=1S/C6H8N2O2/c9-6-4-1-2-7-3-5(4)10-8-6/h7H,1-3H2,(H,8,9) |
| Molecular Structure: | ![(C6H8N2O2) 4,5,6,7-Tetrahydroisoxazolo[5,4-c]pyridin-3(2H)-one;4,5,6,7-Tetrahydroisoxazolo[5,4-c]pyridin-3-ol; ...](https://img1.guidechem.com/chem/e/dict/136/64603-91-4.jpg) |
| Properties | |
| Density: | 1.36 g/cm3 |
| Water Solubility: | ethanol: 0.91 mg/mL |
| Solubility: | ethanol: 0.91 mg/mL |
| Appearance: | white solid |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Biological Activity: | Systemically active GABA A receptor agonist and GABA C receptor antagonist. Displays antinociceptive, anticonvulsant and sedative effects. Hypnotic agent that enhances delta activity within non-REM sleep in rats. |
| Storage Temperature: | Store at RT |
| Color: | white |
| Safety Data | |
| Hazard Symbols | |
 |
|
