| Identification | |
| Name: | Benzenebutanoicacid, a-oxo-, ethyl ester |
| Synonyms: | 2-Oxo-4-phenylbutanoicacid ethyl ester;2-Oxo-4-phenylbutyric acid ethyl ester;4-Phenyl-2-oxobutyricacid ethyl ester;Ethyl 2-oxo-4-phenylbutanoate;Ethyl 3-benzylpyruvate;Ethyl 4-phenyl-2-ketobutyrate;Ethyl4-phenyl-2-oxobutanoate;Ethyl benzylpyruvate; |
| CAS: | 64920-29-2 |
| EINECS: | 265-276-9 |
| Molecular Formula: | C12H14O3 |
| Molecular Weight: | 206.24 |
| InChI: | InChI=1/C12H14O3/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.091 |
| Stability: | No data. |
| Refractive index: | 1.504 |
| Appearance: | Pale yellow or yellow liquid |
| Specification: |
?Ethyl 2-oxo-phenylbutrate , its cas register number 64920-29-2. It also can be called?Benzenebutanoic acid, .alpha.-oxo-, ethyl ester?; and Benzenebutanoic acid, alpha-oxo-, ethyl ester . |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
