| Identification | |
| Name: | 1H-Purine-2,6-dione,3,7-dihydro-3,7-dimethyl-1-(5-oxohexyl)- |
| Synonyms: | Theobromine,1-(5-oxohexyl)- (7CI,8CI);1-(5-Oxohexyl)-3,7-dimethylxanthine;1-(5-Oxohexyl)theobromine;3,7-Dihydro-3,7-dimethyl-1-(5-oxohexyl)-1H-purine-2,6-dione;3,7-Dimethyl-1-(5-oxohexyl)-1H,3H-purin-2,6-dione;3,7-Dimethyl-1-(5-oxohexyl)xanthine;Agapurin;Agapurin Retard;Azupentat;BL191;Dimethyloxohexylxanthine;Durapental;EHT 0202;NSC 637086;Oxpentifylline;Pentoxifyllin;Pentoxifylline;Pentoxiphyllin;Pentoxiphylline;Pentoxyfilline;Pentoxyphyllin;Pexal;Rentylin;Torental;Trental;Vasotal;Vazofirin; |
| CAS: | 6493-05-6 |
| EINECS: | 229-374-5 |
| Molecular Formula: | C13H18N4O3 |
| Molecular Weight: | 278.35 |
| InChI: | InChI=1/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 275.1°C |
| Boiling Point: | 531.3°Cat760mmHg |
| Density: | 1.31g/cm3 |
| Appearance: | White to off-white solid |
| Specification: | White to Off-White Solid usageEng:A metabolite of Pentifylline. Methylxanthine derivative that improves blood flow by decreasing blood viscosity. Phosphodiesterase inhibitor. Inhibits the synthesis of tumor necrosis factor a (TNF-a) Safety Statements:36 36:Wear suitable protective clothing |
| Report: |
EPA Genetic Toxicology Program. |
| Biological Activity: | Phosphodiesterase inhibitor that blocks production of TNF- α and other cytokines. Displays antinociceptive activity. |
| Flash Point: | 275.1°C |
| Storage Temperature: | Store at RT |
| Color: | white |
| Usage: | A metabolite of Pentifylline. Methylxanthine derivative that improves blood flow by decreasing blood viscosity. Phosphodiesterase inhibitor. Inhibits the synthesis of tumor necrosis factor a (TNF-a) |
| Safety Data | |
 |
|
