| Identification | |
| Name: | Hydroxy pentoxifylline |
| Synonyms: | (+/-)-LISOFYLLINE;LISOFYLLINE;HYDROXY PENTOXIFYLLINE;(+/-)-1-(5-HYDROXYHEXYL)-3,7-DIMETHYLXANTHINE;1-(5-Hydroxyhexyl)-3,7-dimethyl-1,2,3,6-tetrahydro-7H-purine-2,6-dione;Penthydroxifillyne |
| CAS: | 6493-06-7 |
| Molecular Formula: | C13H20N4O3 |
| Molecular Weight: | 280.32 |
| InChI: | InChI=1S/C13H20N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-9,18H,4-7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 263°C |
| Boiling Point: | 511.2°Cat760mmHg |
| Density: | 1.32g/cm3 |
| Specification: | White Solid usageEng:A major oxidative metabolite of Pentoxifylline. |
| Flash Point: | 263°C |
| Storage Temperature: | Refrigerator |
| Color: | white |
| Usage: | A major oxidative metabolite of Pentoxifylline. |
| Safety Data | |
 |
|
