| Identification | |
| Name: | 4-Pyridinecarboxaldehyde,3-hydroxy-5-(hydroxymethyl)-2-methyl-, hydrochloride (1:1) |
| Synonyms: | 4-Pyridinecarboxaldehyde,3-hydroxy-5-(hydroxymethyl)-2-methyl-, hydrochloride (9CI);Pyridoxal,hydrochloride (7CI,8CI);2-Methyl-3-hydroxy-4-formyl-5-hydroxymethylpyridinehydrochloride;3-Hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinecarboxaldehydehydrochloride;3-Hydroxy-5-hydroxymethyl-2-methylisonicotinaldehyde hydrochloride; |
| CAS: | 65-22-5 |
| EINECS: | 200-602-5 |
| Molecular Formula: | C8H9NO3.HCl |
| Molecular Weight: | 167.16196 |
| InChI: | InChI=1S/C8H9NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,4,10,12H,3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 200-602-5 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | off-white powder |
| Specification: | White to off-white crystalline powder usageEng:For the labeling of amino acids and their detection in picomolar amounts1; Coenzymes and Cofactors, vol. 1: Vitamin B6, Pyridoxal Phosphate2 Safety Statements:24/25-22-36-26 24/25:Avoid contact with skin and eyes 22:Do not breathe dust 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | −20°C |
| Sensitive: | Hygroscopic |
| Usage: | For the labeling of amino acids and their detection in picomolar amounts1; Coenzymes and Cofactors, vol. 1: Vitamin B6, Pyridoxal Phosphate2 |
| Safety Data | |
 |
|
