| Identification | |
| Name: | N-Acetyl-L-methionine |
| Synonyms: | Methionine, N-acetyl-, L-;L-Methionine, N-acetyl-;Acetyl-L-methionine;Methionamine;Acetylmethionin;(2S)-2-acetamido-4-methylsulfanyl-butanoate;Thiomedon;L-(N-Acetyl)methionine;Ac-L-Met-OH; |
| CAS: | 65-82-7 |
| EINECS: | 200-617-7 |
| Molecular Formula: | C7H13NO3S |
| Molecular Weight: | 191.24 |
| InChI: | InChI=1/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.202 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | -21 ° (C=1, H2O) |
| Alpha: | -20 o (C=4 H2O) |
| Solubility: | Very soluble |
| Appearance: | white crystals |
| Specification: | white crystals Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
EPA TSCA Chemical Inventory, JUNE 1993 |
| HS Code: | 29309070 |
| Safety Data | |
 |
|
