| Identification | |
| Name: | Benzoic acid,2,3,5,6-tetrafluoro-4-methyl- |
| Synonyms: | p-Toluic acid,2,3,5,6-tetrafluoro- (7CI,8CI);2,3,5,6-Tetrafluoro-4-methylbenzoic acid;2,3,5,6-Tetrafluoro-p-toluic acid;NSC 168718; |
| CAS: | 652-32-4 |
| Molecular Formula: | C8H4F4O2 |
| Molecular Weight: | 208.11 |
| InChI: | InChI=1/C8H4F4O2/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1H3,(H,13,14)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 108.5°C |
| Boiling Point: | 255.8°C at 760 mmHg |
| Density: | 1.54 g/cm3 |
| Appearance: | white to almost white crystals or crystalline powder |
| Specification: | white to almost white crystals or Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 108.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
