| Identification | |
| Name: | N-(Cyanoethyl)diethylenetriamine |
| Synonyms: | Diethylenetriamine, N-cyanoethyl-;N-(Cyanoethyl)diethylenetriamine;3-((2-Aminoethyl)amino)propiononitrile, N-(2-aminoethyl) derivative;3-[bis(2-aminoethyl)amino]propanenitrile |
| CAS: | 65216-94-6 |
| EINECS: | 265-639-1 |
| Molecular Formula: | C7H16N4 |
| Molecular Weight: | 156.2287 |
| InChI: | InChI=1/C7H16N4/c8-2-1-5-11(6-3-9)7-4-10/h1,3-7,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.4°C |
| Boiling Point: | 298.6°C at 760 mmHg |
| Density: | 1.027g/cm3 |
| Refractive index: | 1.506 |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 134.4°C |
| Safety Data | |
 |
|
