| Identification |
| Name: | 9,10-Anthracenedione,1,4-dihydroxy-5,8-bis[[2-[(2-hydroxyethyl)amino]ethyl]amino]- |
| Synonyms: | 1,4-Bis[(2-(2-hydroxyethylamino)ethyl)amino]-5,8-dihydroxyanthraquinone;1,4-Dihydroxy-5,8-bis-[[2-[(2-hydroxyethyl)amino]ethyl]amino]anthraquinone;1,4-Dihydroxy-5,8-bis[[2-[(2-hydroxyethyl)amino]ethyl]amino]-9,10-anthracenedione;DHAQ;Dihydroxyanthraquinone;Mitoxanthrone;Mitoxantrone;Mitozantrone;NSC 279836;Novantron;Ralenova; |
| CAS: | 65271-80-9 |
| EINECS: | 274-619-1 |
| Molecular Formula: | C22H28N4O6 |
| Molecular Weight: | 444.48 |
| InChI: | InChI=1/C22H28N4O6/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32/h1-4,23-30H,5-12H2 |
| Molecular Structure: |
![(C22H28N4O6) 1,4-Bis[(2-(2-hydroxyethylamino)ethyl)amino]-5,8-dihydroxyanthraquinone;1,4-Dihydroxy-5,8-bis-[[2-[(...](https://img.guidechem.com/casimg/65271-80-9.gif) |
| Properties |
| Transport: | HAZARD |
| Melting Point: | 170-1740C |
| Density: | 1.45 g/cm3 |
| Refractive index: | 1.709 |
| Solubility: | Sparingly soluble in water; slightly sol in methanol; practically insoluble in acetonitrile chloroform; acetone |
| Appearance: | blue powder |
| Specification: |
?Mitoxantrone (65271-80-9) also can be called Mitozantrone ; Novantron ; DHAQ ; Novantrone ; 9,10-Anthracenedione, 1,4-dihydroxy-5,8-bis((2-((2-hydroxyethyl)amino)ethyl)amino)- ; 1,4-Dihydroxy-5,8-bis[[2-[(2-hydroxyethyl)amino]ethyl]amino]-9,10-anthraquinone .It is a type II topoisomerase inhibitor for disruptting DNA synthesis and DNA repair in both cancer cells and healthy cells.
|
| Color: | Blue-black solid from water ethanol |
| Usage: | A DNA intercalating drug. Inhibits DNA synthesis. Used as an anti-cancer agent |
| Safety Data |
| Hazard Symbols |
|
| |
 |