| Identification | |
| Name: | 2,3,4,5,6-Pentafluorostyrene |
| Synonyms: | Benzene,ethenylpentafluoro- (9CI);Styrene, 2,3,4,5,6-pentafluoro- (6CI,7CI,8CI);(Pentafluorophenyl)ethene;(Perfluorophenyl)ethylene;Ethenylpentafluorobenzene;NSC 97009;Pentafluoro(vinyl)benzene;Pentafluorostyrene;Vinylpentafluorobenzene;ar-Pentafluorostyrene;2',3',4',5',6'-Pentafluorostyrene; |
| CAS: | 653-34-9 |
| EINECS: | 211-500-5 |
| Molecular Formula: | C8H3F5 |
| Molecular Weight: | 194.1014 |
| InChI: | InChI=1S/C8H3F5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.406 |
| Stability: | Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.446 |
| Appearance: | colourless liquid |
| Specification: |
2,3,4,5,6-Pentafluorostyrene , its cas register number is 653-34-9. It also can be called 2',3',4',5',6'-Pentafluorostyrene ; Benzene,ethenylpentafluoro- (9CI) ; (Pentafluorophenyl)ethene .It is a colourless liquid. |
| Packinggroup: | III |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
