| Identification | |
| Name: | Benzoic acid,4-(trans-4-propylcyclohexyl)- |
| Synonyms: | Benzoicacid, 4-(4-propylcyclohexyl)-, trans-; |
| CAS: | 65355-29-5 |
| Molecular Formula: | C16H22O2 |
| Molecular Weight: | 246.34 |
| InChI: | InChI=1/C16H22O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h8-13H,2-7H2,1H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.038 g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
4-trans(4-n-Propyl cyclohexyl)benzoic acid ,its cas register number is 65355-29-5. It also can be called 4-(trans-4-Propylcyclohexyl)benzoic acid ; and Benzoic acid, 4-(trans-4-propylcyclohexyl)- . |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
