| Identification | |
| Name: | 4-(trans-4-Pentylcyclohexyl)benzoic acid |
| Synonyms: | Benzoic acid,4-(4-pentylcyclohexyl)-, trans-;p-(trans-4-Pentylcyclohexyl)benzoic acid; |
| CAS: | 65355-30-8 |
| Molecular Formula: | C18H26O2 |
| Molecular Weight: | 274.4 |
| InChI: | InChI=1/C18H26O2/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h10-15H,2-9H2,1H3,(H,19,20)/t14-,15- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.015 g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
4-trans(4-n-Pentyl cyclohexyl)benzoic acid , its cas register number is 65355-30-8. It also can be called Benzoic acid, 4-(trans-4-pentylcyclohexyl)- ; 4-(trans-4-Pentylcyclohexyl)benzoic acid . |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
