| Identification | |
| Name: | 3H-Pyrazol-3-one,1,2-dihydro-5-methyl-1-(methyl-d3)-2-phenyl- (9CI) |
| Synonyms: | 2-Trideuteromethyl-3-methyl-1-phenyl-3-pyrazolin-5-one;5-Methyl-1-(2H3)methyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one; |
| CAS: | 65566-62-3 |
| Molecular Formula: | C11H9D3N2O |
| Molecular Weight: | 191.24 |
| InChI: | InChI=1/C11H12N2O/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3/i2D3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.752°C |
| Boiling Point: | 318.999°C at 760 mmHg |
| Density: | 1.175g/cm3 |
| Refractive index: | 1.585 |
| Appearance: | off-white with pink cast |
| Specification: | Off-White with pink cast usageEng:Analgesic |
| Flash Point: | 114.752°C |
| Usage: | Analgesic |
| Safety Data | |
 |
|
