| Identification | |
| Name: | 5-Thiazoleethanol,4-methyl-, 5-acetate |
| Synonyms: | 5-Thiazoleethanol,4-methyl-, acetate (6CI);5-Thiazoleethanol, 4-methyl-, acetate (ester)(8CI,9CI);4-Methyl-5-(b-acetoxyethyl)thiazole;5-(2-Acetoxyethyl)-4-methylthiazole;4-Methyl-5-thiazole ethanol acetate; |
| CAS: | 656-53-1 |
| EINECS: | 211-515-7 |
| Molecular Formula: | C8H11NO2S |
| Molecular Weight: | 185.24 |
| InChI: | InChI=1/C8H11NO2S/c1-6-8(12-5-9-6)3-4-11-7(2)10/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 112 |
| Density: | 1.174 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.509-1.511 |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
?4-Methyl-5-thiazolylethyl acetate (CAS NO.656-53-1), its Synonyms are 2-(4-Methyl-5-thiazolyl)ethyl acetate ; 4-Methyl-5-(2-acetoxyethyl)thiazole ; 4-Methyl-5-(2-hydroxyethyl)thiazole acetate ; 4-Methyl-5-(beta-acetoxyethyl)thiazole ; 4-Methyl-5-thiazolylethanol acetate ; 5-(2-Acetoxyethyl)-4-methylthiazole ; 5-Thiazoleethanol, 4-methyl-, acetate ; 5-Thiazoleethanol, 4-methyl-, acetate ester ; Sulfurol acetate . |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
