| Identification | |
| Name: | Pentanedioic acid, dimethyl ester, polymer with 2,2'-thiobis[ethanol] |
| Synonyms: | Pentanedioic acid, dimethyl ester, polymer with 2,2'-thiobis[ethanol] |
| CAS: | 65665-46-5 |
| Molecular Formula: | C11H22O6S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H12O4.C4H10O2S/c1-10-6(8)4-3-5-7(9)11-2;5-1-3-7-4-2-6/h3-5H2,1-2H3;5-6H,1-4H2 |
| Molecular Structure: | ![(C11H22O6S) Pentanedioic acid, dimethyl ester, polymer with 2,2'-thiobis[ethanol]](https://img.guidechem.com/crawlimg/65665-46-5.png) |
| Properties | |
| Flash Point: | 103.3°C |
| Boiling Point: | 211.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 103.3°C |
| Safety Data | |
 |
|
