| Identification | |
| Name: | L-Lysine dihydrochloride |
| CAS: | 657-26-1 |
| EINECS: | 211-518-3 |
| Molecular Formula: | C6H16Cl2N2O2 |
| Molecular Weight: | 219.11 |
| InChI: | InChI=1/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/t5-;;/m0../s1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 15 ° (C=2, H2O) |
| Alpha: | 14 º (C=2, WATER 18 ºC) |
| Appearance: | white to very light yellow crystalline powder |
| Specification: |
The chemical synonyms of L-Lysine dihydrochloride (CAS NO.657-26-1) are L-2,6-diaminohexanoic acid dihydrochloride ; L-(+)-lysine dihydrochloride ; L-lysine dihydrochloride ; H-lys-oh 2hcl9(S)-2,6-diaminohexanoic acid dihydrochloride ; H-lys-oh·2hcl ; Dl-sercine methyl ester hydrochloride .The product of it is widely used in medicine, food and cosmetics industries, nutritional supplements, bio-growth-promoting agent. and that is the essential amino Acids of human body.It shoud avoid breathing dust, vapor, mist or gas. Avoid contact with skin and eyes and stored in a cool, dry place with a tightly closed container. In order to protect personal safety, it must wear chemical splash goggles, wear appropriate protective gloves to prevent skin exposure and wear appropriate protective clothing to prevent skin exposure. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Hygroscopic |
| Usage: | L-lysine is an essential amino acid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
