| Identification |
| Name: | S-HYDROPRENE |
| Synonyms: | s-hydroprene (bsi,ansi,esa,e-iso) |
| CAS: | 65733-18-8 |
| Molecular Formula: | C17H30O2 |
| Molecular Weight: | 266.422 |
| InChI: | InChI=1/C17H30O2/c1-6-19-17(18)13-16(5)12-8-11-15(4)10-7-9-14(2)3/h8,12-15H,6-7,9-11H2,1-5H3/b12-8+,16-13+/t15-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN3082 9/PG 3 |
| Flash Point: | >100 °C |
| Boiling Point: | 339.2°C at 760 mmHg |
| Density: | 0.886g/cm3 |
| Refractive index: | 1.461 |
| Solubility: | In water, 0.54 mg/l. Soluble in common organic solvents. |
| Specification: | Safety Statements:60-61 60:This material and/or its container must be disposed of
as hazardous waste 61:Avoid release to the environment. Refer to special instructions
safety data sheet |
| Flash Point: | >100 °C |
| Color: | Amber liquid |
| Safety Data |
| |
 |