| Identification | |
| Name: | 4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate |
| Synonyms: | 4(1H)-Pyrimidinone,6-amino-2,3-dihydro-2-thioxo-, monohydrate (9CI);4-Amino-2-thioxo-6-pyrimidinonemonohydrate; |
| CAS: | 65802-56-4 |
| EINECS: | 251-501-8 |
| Molecular Formula: | C4H7N3O2S |
| Molecular Weight: | 161.18 |
| InChI: | InChI=1/C4H5N3OS.H2O/c5-2-1-3(8)7-4(9)6-2;/h1H,(H4,5,6,7,8,9);1H2 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | off-white solid |
| Specification: |
4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate (CAS NO.65802-56-4) is also can be called 4-pyrimidinol, 6-amino-2-mercapto-, hydrate (1:1) ; 6-Amino-2-sulfanylpyrimidin-4-ol hydrate (1:1) ; 2-Pyrimidinethiol, 4-amino-6-hydroxy-, monohydrate ; 6-Amino-2,3-dihydro-2-thioxopyrimidin-4(1H)-one monohydrate ; 6-Amino-2-mercapto-4-pyrimidinol monohydrate ; 6-Amino-2-thiouracil Hydrate ; 6-Amino-2-thiouracil monohydrate ; 6-Amino-2-thiouracil monohydrate, 4-Amino-6-hydroxypyrimidine-2-thiol monohydrate . 4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate (CAS NO.65802-56-4) is off-white solid. It is harmful if swallowed and it's irritating to eyes. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Derivatives of 6-Amino-2-thiouracil as novel, potent, and selective A3 adenosine receptor antagonists. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
