| Identification | |
| Name: | Benzeneacetic acid, a-methyl-4-(2-methyl-1-oxopropyl)- |
| Synonyms: | 2-(4-Isobutyrylphenyl)propionicacid |
| CAS: | 65813-55-0 |
| Molecular Formula: | C13H16 O3 |
| Molecular Weight: | 220.26 |
| InChI: | InChI=1/C13H16O3/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9H,1-3H3,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 196.555°C |
| Boiling Point: | 377.952°C at 760 mmHg |
| Density: | 1.107g/cm3 |
| Refractive index: | 1.528 |
| Specification: | White Solid usageEng:1-Oxo Ibuprofen, is a degradation product of Ibuprofen arising from oxidative and thermal treatments. 1-Oxo Ibuprofen is the Ibuprofen impurity J. |
| Flash Point: | 196.555°C |
| Usage: | Degradation product of Ibuprofen arising from oxidative and thermal treatments. Ibuprofen impurity J |
| Safety Data | |
 |
|
