| Identification | |
| Name: | L-Ascorbicacid, 2-(dihydrogen phosphate), sodium salt (1:3) |
| Synonyms: | L-Ascorbicacid, 2-(dihydrogen phosphate), trisodium salt (9CI);Ascorbic acid phosphatesodium salt;Sodium ascorbyl phosphate;Stay-C 50;Trisodiumascorbate-2-phosphate;VCP-NA;Sodium Ascorbyl Phosphate(SAP); |
| CAS: | 66170-10-3 |
| Molecular Formula: | C6H6Na3O9P |
| Molecular Weight: | 322.05 |
| InChI: | InChI=1/C6H8O6.3Na.H3O4P/c7-1-2(8)5-3(9)4(10)6(11)12-5;;;;1-5(2,3)4/h2,5,7-10H,1H2;;;;(H3,1,2,3,4)/q;3*+1;/p-3/t2-,5+;;;;/m0..../s1 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
L-Ascorbicacid, 2-(dihydrogen phosphate), sodium salt (1:3) , its cas register number 66170-10-3. It also can be called Sodium L-ascorbyl-2-phosphate ; 2-Phospho-L-ascorbic acid trisodium salt ; and L-Ascorbic acid 2-phosphate trisodium salt . |
| Safety Data | |
 |
|
