| Identification | |
| Name: | Cyromazine |
| Synonyms: | 1,3,5-Triazine-2,4,6-triamine,N-cyclopropyl- (9CI);2,4-Diamino-6-(cyclopropylamino)-s-triazine;2-Cyclopropylamino-4,6-diamino-s-triazine;CGA 72662;Citation;Cyclopropylmelamine; |
| CAS: | 66215-27-8 |
| EINECS: | 266-257-8 |
| Molecular Formula: | C6H10N6 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C6H10N6/c7-4-10-5(8)12-6(11-4)9-3-1-2-3/h3H,1-2H2,(H5,7,8,9,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.622 g/cm3 |
| Stability: | No hydrolysis was observed < or = 70 C for 28 days. Stable < 310 C. |
| Solubility: | 11 g/L (20 C) |
| Appearance: | white crystals |
| Specification: |
?Cyromazine , its cas register number is 66215-27-8. It also can be called N-cyclopropyl-1,3,5-triazine-2,4,6-triamine ; 2-Cyclopropylamino-4,6-diamino-s-triazine ; Diamino-6-(cyclopropylamino)-s-triazine ; Cyclopropyl-1,3,5-triazine-2,4,6-triamine ; Cyclopropylmelamine ; Larvadex ; OMS-2014 ; Trigard .It is a?crystals.It?works by affecting the nervous system of the immature larval stages of certain insects. |
| Color: | Colorless crystals White crystalline solid |
| Usage: | Insect growth regulator. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
