| Identification | |
| Name: | Carbamic acid,N-(2-cyanoacetyl)-, ethyl ester |
| Synonyms: | Carbamicacid, (cyanoacetyl)-, ethyl ester (6CI,7CI,8CI,9CI); Cyanoacetylurethan; EthylN-(cyanoacetyl)carbamate; Ethyl cyanoacetylcarbamate;N-Carbethoxy-2-cyanoacetamide; N-Cyanoacetylurethane; NSC 59709 |
| CAS: | 6629-04-5 |
| EINECS: | 229-615-4 |
| Molecular Formula: | C6H8 N2 O3 |
| Molecular Weight: | 156.16 |
| InChI: | InChI=1/C6H8N2O3/c1-2-11-6(10)8-5(9)3-4-7/h2-3H2,1H3,(H,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 167-169 °C(lit.) |
| Density: | 1.197g/cm3 |
| Refractive index: | 1.451 |
| Specification: |
N-Cyanoacetyl ethyl carbamate (CAS NO.6629-04-5) is also called 2-Cyanoacetylurethane ; Carbamic acid, (cyanoacetyl)-, ethyl ester ; Cyanoacetyl-carbamicaciethylester ; Cyanoacetylurethan ; Ethyl cyanacetylcarbamate ; Ethyl n-(2-cyanoacetyl)carbamate . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
