| Identification |
| Name: | Benzaldehyde,4-hydroxy-3-methoxy-5-nitro- |
| Synonyms: | Vanillin,5-nitro- (6CI,7CI,8CI);3-Methoxy-4-hydroxy-5-nitrobenzaldehyde;3-Nitro-4-hydroxy-5-methoxybenzaldehyde;4-Hydroxy-3-methoxy-5-nitrobenzaldehyde;4-Hydroxy-5-methoxy-3-nitrobenzaldehyde;5-Nitro-4-hydroxy-3-methoxybenzaldehyde;NSC 16932;NSC 35352;5-nitrovalillin; |
| CAS: | 6635-20-7 |
| EINECS: | 229-633-2 |
| Molecular Formula: | C8H7NO5 |
| Molecular Weight: | 197.15 |
| InChI: | InChI=1/C8H7NO5/c1-14-7-3-5(4-10)2-6(8(7)11)9(12)13/h2-4,11H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.456 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.629 |
| Solubility: | Insoluble |
| Appearance: | Yellow to green powder. |
| HS Code: | 29130000 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
