| Identification | |
| Name: | Selenoaspirine |
| Synonyms: | 2-(Acetylseleno)benzoic acid;Selenoaspirine |
| CAS: | 66472-85-3 |
| Molecular Formula: | C9H8O3Se |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H8O3Se/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 188.8°C |
| Boiling Point: | 388.6°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Selenoaspirine , its cas register number is 66472-85-3. It also can be called 2-(Acetylseleno)benzoic acid ; Benzoic acid, 2-(acetylseleno)- ; and Acide acetyl seleno-2 benzoique . |
| Flash Point: | 188.8°C |
| Safety Data | |
 |
|
